| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Di-t-butylphosphino-2'-(N,N-dimethylamino)biphenyl Basic information | | Reaction |
| Product Name: | 2-Di-t-butylphosphino-2'-(N,N-dimethylamino)biphenyl | | Synonyms: | 2'-[Bis(1,1-dimethylethyl)phosphino]-N,N-dimethyl-[1,1'-biphenyl]-2-amine;2-Di-tert-butylphosphino-2'-(N,N-dimethylamino)biphenyl,98%;2-[2-(di-tert-butylphosphanyl)phenyl]-N,N-diMethylaniline;98% tBuDavePhos;2-(Di-tert-butylphosphiNA)-2'-(N,N-diMethylaMiNA)biphenyl;2-(Di-tert-butylphosphino)-2'-;2-Di-t-butylphosphino-2'-(N,N-diMethylaMino)biphenyl,98% tBuDavePhos;t-BuDavePhos 97% | | CAS: | 224311-49-3 | | MF: | C22H32NP | | MW: | 341.47 | | EINECS: | 607-073-3 | | Product Categories: | Phosphines;Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | 224311-49-3.mol |  |
| | 2-Di-t-butylphosphino-2'-(N,N-dimethylamino)biphenyl Chemical Properties |
| Melting point | 115-117 °C | | Boiling point | 451.6±38.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 5.07±0.18(Predicted) | | form | crystal | | color | white | | Sensitive | Air Sensitive | | InChI | InChI=1S/C22H32NP/c1-21(2,3)24(22(4,5)6)20-16-12-10-14-18(20)17-13-9-11-15-19(17)23(7)8/h9-16H,1-8H3 | | InChIKey | PHLPNEHPCYZBNZ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2P(C(C)(C)C)C(C)(C)C)=CC=CC=C1N(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | 2-Di-t-butylphosphino-2'-(N,N-dimethylamino)biphenyl Usage And Synthesis |
| Reaction |
- Useful ligand for Pd-catalyzed carbon-oxygen bond forming reactions.
- Ligand used selective Pd-catalyzed arylation of ammonia. Application to the synthesis of dibenzodiazepines.
- Ligand used for selective Pd-catalyzed silylation of aryl chlorides.
- Ligand used for Pd(0)-catalyzed direct dehydrative coupling of terminal alkynes with allylic alcohols to access 1,4-enynes.
| | Chemical Properties | White crystals or crystalline powder | | Uses | suzuki reaction | | reaction suitability | reagent type: ligand
reaction type: Arylations
reagent type: ligand
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reagent type: ligand
reaction type: C-X Bond Formation | | Synthesis | The target compound 2-di-tert-butylphosphine-2-(N,N-dimethylamino)biphenyl was prepared by the Suzuki reaction using 2-bromochlorobenzene as starting material, followed by the reaction with di-tert-butylphosphonium chloride. |
| | 2-Di-t-butylphosphino-2'-(N,N-dimethylamino)biphenyl Preparation Products And Raw materials |
|