| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(Dicyclohexylphosphino)-2'-methoxybiphenyl Basic information |
| Product Name: | 2-(Dicyclohexylphosphino)-2'-methoxybiphenyl | | Synonyms: | 2-(Dicyclohexylphosphino)-2'-methoxy-1,1'-biphenyl;2-(Dicyclohexylphosphino)-2'-methoxybiphenyl;2-(DicyclohexylphosphiNA)-2'-Methoxybiphenyl;dicyclohexyl-[2-(2-methoxyphenyl)phenyl]phosphane;Dicyclohexyl(2'-methoxybiphenyl-2-yl)phosphine;Dicyclohexyl(2'-methoxy-[1,1'-biphenyl]-2-yl);dicycloh;phosphino)-2'-methoxybiphenyL | | CAS: | 255835-82-6 | | MF: | C25H33OP | | MW: | 380.5 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 255835-82-6.mol |  |
| | 2-(Dicyclohexylphosphino)-2'-methoxybiphenyl Chemical Properties |
| Melting point | 120-122℃ | | Boiling point | 504.7±33.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C25H33OP/c1-26-24-18-10-8-16-22(24)23-17-9-11-19-25(23)27(20-12-4-2-5-13-20)21-14-6-3-7-15-21/h8-11,16-21H,2-7,12-15H2,1H3 | | InChIKey | YXJPHYNYXMEWKW-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)C1=CC=CC=C1C1=CC=CC=C1OC |
| | 2-(Dicyclohexylphosphino)-2'-methoxybiphenyl Usage And Synthesis |
| | 2-(Dicyclohexylphosphino)-2'-methoxybiphenyl Preparation Products And Raw materials |
|