| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- Incensole acetate
-
- $1.00
-
2026-10-10
- CAS:34701-53-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- Incensole acetate
-
-
2023-02-24
- CAS:34701-53-6
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 100 g
|
| | Incensole acetate Basic information |
| Product Name: | Incensole acetate | | Synonyms: | Incensole acetate;(1R,2S,5E,9E,12S)-rel-1,5,9-Trimethyl-12-(1-methylethyl)-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol 2-acetate;Acetyl incensole;15-Oxabicyclo[10.2.1]pentadeca-5,9-dien-2-ol, 1,5,9-trimethyl-12-(1-methylethyl)-, 2-acetate, (1R,2S,5E,9E,12S)-;Insencol Acetate;(1R,2S,5E,9E,12S)-12-isopropyl-1,5,9-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl acetate | | CAS: | 34701-53-6 | | MF: | C22H36O3 | | MW: | 348.52 | | EINECS: | 202-110-6 | | Product Categories: | | | Mol File: | 34701-53-6.mol |  |
| | Incensole acetate Chemical Properties |
| Boiling point | 420.1±45.0 °C(Predicted) | | density | 0.99±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF:25.0(Max Conc. mg/mL);71.73(Max Conc. mM)
DMSO:25.0(Max Conc. mg/mL);71.73(Max Conc. mM)
Ethanol:25.0(Max Conc. mg/mL);71.73(Max Conc. mM) | | form | liquid | | color | Clear oily | | Water Solubility | slightly soluble in water | | Major Application | food and beverages | | InChIKey | HVBACKJYWZTKCA-XSLBTUIJSA-N | | SMILES | O1[C@]2([C@H](CC\C(=C\CC\C(=C\C[C@@]1(CC2)C(C)C)\C)\C)OC(=O)C)C |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | Incensole acetate Usage And Synthesis |
| Uses | Insencol Acetate is a neuroactive and antiinflammatory agent. Acts on transient receptor potential vanillaloid 3 (TRPV3) activation and the inhibition of NF-κB. | | target | NF-kB | TRPV | TGF-β/Smad | TNF-α | IL Receptor |
| | Incensole acetate Preparation Products And Raw materials |
|