- BRD4770
-
- $38.00
-
2026-06-02
- CAS:1374601-40-7
- Purity: 99.53%
- Supply Ability: 10g
|
| | BRD4770 Basic information |
| Product Name: | BRD4770 | | Synonyms: | BRD4770;methyl 2-benzamido-1-(3-phenylpropyl)-1H-benzo[d]imidazole-5-carboxylate;methyl 2-benzamido-1-(3-phenylpropyl)-1H-benzo[d]imidazole-5-carboxylate BRD4770;2-(Benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylic acid methyl ester;CS-1814;Methyl-2-(benzoylamino)-1-(3-phenylpropyl)-1H-benzimidazole-5-carboxylate;BRD-4770; BRD 4770;Methyl 2-benzamido-1-(3-phenylpropyl)benzimidazole-5-carboxylate | | CAS: | 1374601-40-7 | | MF: | C25H23N3O3 | | MW: | 413.47 | | EINECS: | 802-776-3 | | Product Categories: | Inhibitors | | Mol File: | 1374601-40-7.mol |  |
| | BRD4770 Chemical Properties |
| density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble5mg/mL, clear (warmed) | | pka | 12.12±0.43(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C25H23N3O3/c1-31-24(30)20-14-15-22-21(17-20)26-25(27-23(29)19-12-6-3-7-13-19)28(22)16-8-11-18-9-4-2-5-10-18/h2-7,9-10,12-15,17H,8,11,16H2,1H3,(H,26,27,29) | | InChIKey | UCGWYCMPZXDHNR-UHFFFAOYSA-N | | SMILES | C1(NC(=O)C2=CC=CC=C2)N(CCCC2=CC=CC=C2)C2=CC=C(C(OC)=O)C=C2N=1 | | CAS DataBase Reference | 1374601-40-7 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BRD4770 Usage And Synthesis |
| Uses | BRD4770 is an inhibitor of euchromatin histone methyltransferase 2 (EHMT2), also known as G9a, decreasing di- and trimethylation on lysine 9 of histone 3 (EC50 = 5 μM). Through its effects on EHMT2, BRD4770 induces senescence in the pancreatic cancer cell line PANC-1 without initiating apoptosis. It also blocks both anchorage-dependent and –independent proliferation of PANC-1 cells.[Cayman Chemical] | | Definition | ChEBI: 2-benzamido-1-(3-phenylpropyl)-5-benzimidazolecarboxylic acid methyl ester is a member of benzimidazoles. | | Biochem/physiol Actions | BRD4770 is a selective inhibitor of the histone methyltransferase G9a. BRD4770 blocks lysine residue 9 methylation of histone H3 without inducing apoptosis. In PANC-1 cells, BRD4770 activates the ataxia telangiectasia mutated (ATM) pathway, induces senescence and inhibits anchorage-dependent and -independent growth. | | IC 50 | EHMT2/G9a/KMT1C |
| | BRD4770 Preparation Products And Raw materials |
|