| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | 2-chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine Basic information |
| Product Name: | 2-chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine | | Synonyms: | 1,3,5-triazine,2-chloro-4,6-di-1-naphthalenyl-;2-chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine;2-Chloro-4,6-di(1-naphthyl)-1,3,5-triazine | | CAS: | 78941-32-9 | | MF: | C23H14ClN3 | | MW: | 367.83 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 78941-32-9.mol |  |
| | 2-chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine Chemical Properties |
| Melting point | 150 °C | | Boiling point | 645.8±38.0 °C(Predicted) | | density | 1.314±0.06 g/cm3(Predicted) | | pka | -0.19±0.10(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C23H14ClN3/c24-23-26-21(19-13-5-9-15-7-1-3-11-17(15)19)25-22(27-23)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H | | InChIKey | KQKCYBIGRDRFJT-UHFFFAOYSA-N | | SMILES | N1=C(C2=C3C(C=CC=C3)=CC=C2)N=C(C2=C3C(C=CC=C3)=CC=C2)N=C1Cl | | CAS DataBase Reference | 78941-32-9 |
| | 2-chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine Usage And Synthesis |
| Uses |
2-chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine is a solid and can be used as a pharmaceutical intermediate.
|
| | 2-chloro-4,6-di(naphthalen-1-yl)-1,3,5-triazine Preparation Products And Raw materials |
|