| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Dehydroepiandrosterone-[D6] (CertiMass solution) Basic information |
| Product Name: | Dehydroepiandrosterone-[D6] (CertiMass solution) | | Synonyms: | Dehydroepiandrosterone-[D6] (CertiMass solution);p-Coumaric acid-[13C3];P-COUMARIC ACID (PROPYL-13C3, 99%) CP 99%+;p-Coumaric acid-1,2,3-13C3 99 atom % 13C, 99% (CP);p-Coumaric acid-1,2,3-13C?;13C3]-p-Coumaric acid;2-Propenoic-1,2,3-13C3 acid, 3-(4-hydroxyphenyl)-, (2E)-;p-Coumaric acid-1,2,3-13C3 | | CAS: | 1261170-80-2 | | MF: | C9H8O3 | | MW: | 167.14 | | EINECS: | | | Product Categories: | | | Mol File: | 1261170-80-2.mol | ![Dehydroepiandrosterone-[D6] (CertiMass solution) Structure](CAS/20240320/GIF/1261170-80-2.gif) |
| | Dehydroepiandrosterone-[D6] (CertiMass solution) Chemical Properties |
| Melting point | 214°C (dec) (lit.) | | density | 1.330±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | form | solid | | InChI | 1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+/i3+1,6+1,9+1 | | InChIKey | NGSWKAQJJWESNS-FJXVDKIJSA-N | | SMILES | O[13C](/[13CH]=[13CH]/C1=CC=C(O)C=C1)=O | | CAS Number Unlabeled | 501-98-4 |
| WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Dehydroepiandrosterone-[D6] (CertiMass solution) Usage And Synthesis |
| Uses | p-Coumaric acid-13C3 is the 13C-labeled p-Coumaric acid. p-Coumaric acid is the abundant isomer of cinnamic acid which has antitumor and anti-mutagenic activities. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110
[2] Jaganathan SK, et al. Events associated with apoptotic effect of p-Coumaric acid in HCT-15 colon cancer cells. World J Gastroenterol. 2013 Nov 21;19(43):7726-34. DOI:10.3748/wjg.v19.i43.7726 |
| | Dehydroepiandrosterone-[D6] (CertiMass solution) Preparation Products And Raw materials |
|