|
|
| | 3-Hydroxycinnamic acid Basic information |
| | 3-Hydroxycinnamic acid Chemical Properties |
| Melting point | 193-195 °C(lit.) | | Boiling point | 231.61°C (rough estimate) | | density | 1.1403 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol,Benzene,Ethanol,Ether | | pka | 4.38±0.10(Predicted) | | form | Fine Crystalline Powder | | color | Beige | | Water Solubility | slightly soluble in water | | BRN | 2690254 | | InChI | 1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4+ | | InChIKey | KKSDGJDHHZEWEP-SNAWJCMRSA-N | | SMILES | OC(/C=C/C1=CC=CC(O)=C1)=O | | LogP | 1.826 (est) | | CAS DataBase Reference | 14755-02-3(CAS DataBase Reference) | | NIST Chemistry Reference | m-Hydroxycinnamic acid(14755-02-3) | | EPA Substance Registry System | 2-Propenoic acid, 3-(3-hydroxyphenyl)-, (2E)- (14755-02-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-37/39-26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Hydroxycinnamic acid Usage And Synthesis |
| Chemical Properties | beige fine crystalline powder | | Uses | food and beverages | | Definition | ChEBI: 3-coumaric acid is a monohydroxycinnamic acid in which the hydroxy substituent is located at C-3 of the phenyl ring. It has a role as a human xenobiotic metabolite and a plant metabolite. It is a conjugate acid of a 3-coumarate. |
| | 3-Hydroxycinnamic acid Preparation Products And Raw materials |
|