|
|
| | Febuxostat Impurity 8 Basic information |
| Product Name: | Febuxostat Impurity 8 | | Synonyms: | Febuxostat-18;2-[3-formyl-4-(2-methylpropoxy)phenyl]-4-methyl-5-thiazole carboxylic acid;Febuxostat Impurity 9/2-(3-formyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylic acid;Febuxostat Impurity 8;Febuxostat ImpurityF;Febuxostat Impurity L;FeBuxostat Impurity 29;Febuxostat Impurity Z19 | | CAS: | 144060-62-8 | | MF: | C16H17NO4S | | MW: | 319.38 | | EINECS: | | | Product Categories: | | | Mol File: | 144060-62-8.mol |  |
| | Febuxostat Impurity 8 Chemical Properties |
| Boiling point | 535.0±60.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly. Sonicated) | | form | Solid | | pka | 1.22±0.37(Predicted) | | color | Off-White to Pale Yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C16H17NO4S/c1-9(2)8-21-13-5-4-11(6-12(13)7-18)15-17-10(3)14(22-15)16(19)20/h4-7,9H,8H2,1-3H3,(H,19,20) | | InChIKey | OHIQHHXCAMMCPH-UHFFFAOYSA-N | | SMILES | S1C(C(O)=O)=C(C)N=C1C1=CC=C(OCC(C)C)C(C=O)=C1 |
| | Febuxostat Impurity 8 Usage And Synthesis |
| Uses | 3-Descyano-3-formyl Febuxostat is an impurity of Febuxostat (F229000), a xanthine oxidase/xanthine dehydrogenase inhibitor that is used for treating hyperuricemia and chronic gout. |
| | Febuxostat Impurity 8 Preparation Products And Raw materials |
|