|
|
| | 2,5-Diamino-1,4-benzenedithiol dihydrochloride Basic information | | Application |
| Product Name: | 2,5-Diamino-1,4-benzenedithiol dihydrochloride | | Synonyms: | 2,5-DIMERCAPTO-1,4-PHENYLENEDIAMINE DIHYDROCHLORIDE;2,5-DiaMino-1,4-benzenedithiol diHCl;1,4-Diamino-2,5-benzenedithiol·dihydrochloride;2,5-Diaminobenzene-1,4-bisthiol·dihydrochloride;2,5-DIAMINO-1,4-BENZENEDITHIOL 2HCL;2,5-Diamino-1,4-benzenedithiolDihydrochloride>;2,5-diamino-1,4-phenyldithiol dihydrochloride;2,5-DiaMinobenzene-1,4-dithiol dihydrochloride | | CAS: | 75464-52-7 | | MF: | C6H10Cl2N2S2 | | MW: | 245.19 | | EINECS: | | | Product Categories: | Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research | | Mol File: | 75464-52-7.mol |  |
| | 2,5-Diamino-1,4-benzenedithiol dihydrochloride Chemical Properties |
| Melting point | 210°C(dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Dimethylformamide | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C6H8N2S2.2ClH/c7-3-1-5(9)4(8)2-6(3)10;;/h1-2,9-10H,7-8H2;2*1H | | InChIKey | HVXLKRWRWNFGBA-UHFFFAOYSA-N | | SMILES | C1(N)C=C(C(N)=CC=1S)S.Cl.Cl | | CAS DataBase Reference | 75464-52-7 |
| | 2,5-Diamino-1,4-benzenedithiol dihydrochloride Usage And Synthesis |
| Application | 2,5-Diamino-1,4-benzyldithiophene dihydrochloride can be used as an organic solvent and as an intermediate in organic synthesis. Examples of its applications are as follows:
1) Preparation of an electrical storage device based on a one-dimensional organic-inorganic hybrid polymer chain.
2) Preparation of pure 4,4'-[1,3]thiazo[4,5-f][1,3]benzothiazo-2,6-dimethyldiphenylamine. | | Chemical Properties | Light yellow solid |
| | 2,5-Diamino-1,4-benzenedithiol dihydrochloride Preparation Products And Raw materials |
|