|
|
| | 1,3-Diaminoguanidine monohydrochloride Basic information |
| | 1,3-Diaminoguanidine monohydrochloride Chemical Properties |
| Melting point | 180-182 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | water: soluble50mg/mL, clear to very slightly hazy, colorless to faintly yellow | | form | Granular Powder | | color | White to light beige | | Water Solubility | very faint turbidity | | Sensitive | Hygroscopic | | BRN | 3556702 | | InChI | InChI=1S/CH7N5.ClH/c2-1(5-3)6-4;/h3-4H2,(H3,2,5,6);1H | | InChIKey | HAZRIBSLCUYMQP-UHFFFAOYSA-N | | SMILES | C(=N)(NN)NN.Cl | | CAS DataBase Reference | 36062-19-8(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HS Code | 29212900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Diaminoguanidine monohydrochloride Usage And Synthesis |
| Chemical Properties | white to light beige granular powder | | Uses | N,N''-Diaminoguanidine Monohydrochloride is an analyte for HPLC. It also functions as an intermediate for the synthesis of energetic salts or materials based on dinitroguanidine. | | General Description | 1,3-Diaminoguanidine monohydrochloride undergoes condensation reaction with:
- 4-isothiocyanato-4-methylpentane-2-one to yield condensed pyrimidines
- various aldehydes and ketones to yield bis guanidine derivatives
|
| | 1,3-Diaminoguanidine monohydrochloride Preparation Products And Raw materials |
|