|
|
| | 4-Methoxybenzoic acid sodium salt Basic information |
| | 4-Methoxybenzoic acid sodium salt Chemical Properties |
| Boiling point | 424℃[at 101 325 Pa] | | density | 1.507[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | Store below +30°C. | | solubility | DMSO (Slightly), Water (Slightly) | | pka | 4.42[at 20 ℃] | | form | Solid | | color | White to Off-White | | Water Solubility | 135g/L at 20℃ | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | ANTIMICROBIAL
FRAGRANCE
pH ADJUSTERS
FLAVOURING | | InChI | InChI=1S/C8H8O3.Na/c1-11-7-4-2-6(3-5-7)8(9)10;/h2-5H,1H3,(H,9,10);/q;+1/p-1 | | InChIKey | AETSDHMVQHOYPB-UHFFFAOYSA-M | | SMILES | C1(C([O-])=O)=CC=C(OC)C=C1.[Na+] | | LogP | -0.53 at 23℃ |
| WGK Germany | WGK 1 slightly water endangering | | HS Code | 2918 99 90 | | Storage Class | 11 - Combustible Solids |
| | 4-Methoxybenzoic acid sodium salt Usage And Synthesis |
| Description | Sodium Anisate is the sodium salt of p-Anisic Acid. | | General Description | for synthesis | | Flammability and Explosibility | Not classified |
| | 4-Methoxybenzoic acid sodium salt Preparation Products And Raw materials |
|