| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Sodium 4-hydroxybenzoate Basic information |
| | Sodium 4-hydroxybenzoate Chemical Properties |
| Melting point | >300 °C(lit.) | | density | 0.100345 g/cm³(Temp: 30 °C) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | White to light beige | | Water Solubility | Soluble in water. | | BRN | 4163553 | | Major Application | food and beverages | | Cosmetics Ingredients Functions | PRESERVATIVE | | InChI | InChI=1S/C7H6O3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1 | | InChIKey | ZLVSYODPTJZFMK-UHFFFAOYSA-M | | SMILES | C1(C=CC(O)=CC=1)C([O-])=O.[Na+] | | CAS DataBase Reference | 114-63-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 4-hydroxy-, monosodium salt (114-63-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | DH2900000 | | F | 3 | | TSCA | TSCA listed | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | | Toxicity | mouse,LD50,intravenous,1200mg/kg (1200mg/kg),Journal of the American Pharmaceutical Association, Scientific Edition. Vol. 45, Pg. 260, 1956. |
| | Sodium 4-hydroxybenzoate Usage And Synthesis |
| Chemical Properties | White to light beige crystalline powder | | Uses | It is used as a pharmaceutical intermediate. | | Definition | ChEBI: An organic sodium salt resulting from the replacement of the proton from the carboxy group of 4-hydroxybenzoic acid by a sodium ion. |
| | Sodium 4-hydroxybenzoate Preparation Products And Raw materials |
|