|
|
| | 5-Methyl-1,3-benzenediacetonitrile Basic information |
| | 5-Methyl-1,3-benzenediacetonitrile Chemical Properties |
| Melting point | 71-72°C | | Boiling point | 225°C/14mmHg(lit.) | | density | 1.076±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Ethyl Acetate (Slightly), Met | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C11H10N2/c1-9-6-10(2-4-12)8-11(7-9)3-5-13/h6-8H,2-3H2,1H3 | | InChIKey | XJCXEUYJQHPEAE-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC(C)=CC(CC#N)=C1 | | CAS DataBase Reference | 120511-74-2(CAS DataBase Reference) |
| RIDADR | UN 3439 6.1/PG III | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 |
| | 5-Methyl-1,3-benzenediacetonitrile Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 5-Methyl-1,3-benzenediacetonitrile is an Anastrozole intermediate. Anastrozole 1,3-Dicyanomethyl Impurity. Anastrozole is an aromatase inhibitor and used as an antineoplastic. |
| | 5-Methyl-1,3-benzenediacetonitrile Preparation Products And Raw materials |
|