|
|
| | p-Nitrophenylacetonitrile Basic information |
| | p-Nitrophenylacetonitrile Chemical Properties |
| Melting point | 113-115 °C(lit.) | | Boiling point | 195-197 °C (12.0016 mmHg) | | density | 1.3264 (rough estimate) | | refractive index | 1.5770 (estimate) | | storage temp. | Store below +30°C. | | solubility | Solubility Insoluble in water, soluble in ethanol, ether | | form | Crystalline Powder | | color | Cream to yellow | | PH Range | Yellow (11.4) to Orange-red (12.9) | | Water Solubility | INSOLUBLE | | Merck | 14,6590 | | BRN | 388442 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | Major Application | Recording materials, photography, forge-proof security paper | | InChI | 1S/C8H6N2O2/c9-6-5-7-1-3-8(4-2-7)10(11)12/h1-4H,5H2 | | InChIKey | PXNJGLAVKOXITN-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(CC#N)cc1 | | CAS DataBase Reference | 555-21-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneacetonitrile, 4-nitro-(555-21-5) | | EPA Substance Registry System | Benzeneacetonitrile, 4-nitro- (555-21-5) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 14-22-36/37-36-26-24/25 | | RIDADR | 3439 | | WGK Germany | 3 | | RTECS | AM1250000 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 ivn-mus: 32 mg/kg CSLNX* NX#02093 |
| | p-Nitrophenylacetonitrile Usage And Synthesis |
| Chemical Properties | Cream to yellow crystalline powder | | Uses | p-Nitrophenylacetonitrile is used as a radical inhibitor in the polymerization of vinyl acetate. | | Uses | In the preparation of p-nitrophenylacetic acid. | | Uses | 4-Nitrophenylacetonitrile is used as a radical inhibitor in the polymerization of vinyl acetate. Toxic compound to tetrahymena pyriformis. | | Synthesis Reference(s) | Tetrahedron Letters, 20, p. 1361, 1979 DOI: 10.1016/S0040-4039(01)86150-5 The Journal of Organic Chemistry, 52, p. 648, 1987 DOI: 10.1021/jo00380a028 | | Hazard | Toxic material | | Safety Profile | Poison by intravenous route. When heated to decomposition it emits toxic fumes of NOx and CNí. See also NITRILES and NITRO COMPOUNDS OF AROMATIC HYDROCARBONS | | Purification Methods | Crystallise the nitrile from EtOH. TOXIC. [Beilstein 9 H 456, 9 I 183, 9 II 313, 9 III 2291.] |
| | p-Nitrophenylacetonitrile Preparation Products And Raw materials |
|