| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- LDN-212320
-
- $33.00
-
2026-09-10
- CAS:894002-50-7
- Purity: 98.18%
- Supply Ability: 10g
|
| | LDN-212320 Basic information |
| Product Name: | LDN-212320 | | Synonyms: | LDN-212320;LDN-0212320;3-[[(2-Methylphenyl)methyl]thio]-6-(2-pyridinyl)-pyridazine;(3-[(2-methylbenzyl)sulfenyl]-6-(pyridine-2-yl)pyridazine);LDN/OSU-0212320;LDN/OSU-0212320;LDN-0212320;OSU-0212320;OSU-0212320;3-((2-methylbenzyl)thio)-6-(pyridin-2-yl)pyridazine | | CAS: | 894002-50-7 | | MF: | C17H15N3S | | MW: | 293.39 | | EINECS: | | | Product Categories: | | | Mol File: | 894002-50-7.mol |  |
| | LDN-212320 Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO : 50 mg/mL (170.42 mM; Need ultrasonic) | | form | Powder | | color | White to gray | | InChI | InChI=1S/C17H15N3S/c1-13-6-2-3-7-14(13)12-21-17-10-9-16(19-20-17)15-8-4-5-11-18-15/h2-11H,12H2,1H3 | | InChIKey | DUUQLWDHNYFUPP-UHFFFAOYSA-N | | SMILES | C1(SCC2=CC=CC=C2C)=NN=C(C2=NC=CC=C2)C=C1 |
| | LDN-212320 Usage And Synthesis |
| Uses | LDN 212320 is a small molecule activator of glutamate transporter EAAT2 translation, which provides neuroprotection and shows potential for the therapeutic treatment of neurodegenerative diseases. | | in vivo | LDN-212320 (10 or 20 mg/kg, i.p) significantly attenuates formalin-evoked nociceptive behavior[1].
LDN-212320 (10 or 20 mg/kg, i.p) significantly reverses formalin-induced impaired hippocampal-dependent behavior. In addition, LDN-212320 (10 or 20 mg/kg, i.p) increases GLT-1 expressions in the hippocampus and ACC[1].
LDN-212320 (20 mg/kg, i.p) significantly reduced formalin induced-ERK phosphorylation, a marker of nociception, in the hippocampus and ACC[1].
| Animal Model: | Mice[1]. | | Dosage: | 10 or 20 mg/kg. | | Administration: | IP 24 h before the injection of formalin. | | Result: | Significantly attenuated licking and biting behavior during both phases 1 and 2 in a dose-dependent manner compared to formalin-injected mice.
Significantly (P < 0.01 or P < 0.001) reduced the licking and biting behavior.
Significantly increased preference for the displaced object (F3, 13 = 28.03, P < 0.01) compared to formalin-injected mice.
Significantly (P < 0.001) increased interaction time with the displaced object compared to formalin-injected mice.
|
| | IC 50 | EAAT2 |
| | LDN-212320 Preparation Products And Raw materials |
|