7-Diethylaminocoumarin-3-carboxylic acid, succinimidyl ester manufacturers
- DEAC, SE
-
- $38.00
-
2026-07-15
- CAS:139346-57-9
- Purity: 99.71%
- Supply Ability: 10g
|
| | 7-Diethylaminocoumarin-3-carboxylic acid, succinimidyl ester Basic information |
| Product Name: | 7-Diethylaminocoumarin-3-carboxylic acid, succinimidyl ester | | Synonyms: | N-SUCCINIMIDYL 7-(DIETHYLAMINO)COUMARIN-3-CARBOXYLATE;SUCCINIMIDYL 7-DIETHYLAMINOCOUMARIN-3-CARBOXYLATE;DEAC, SE;7-(DIETHYLAMINO)COUMARIN-3-CARBOXYLIC ACID N-SUCCINIMIDYL ESTER;7-(Diethylamino)coumarin-3-carboxylic acid N-succinimidyl ester, 96%, BioReagent, suitable for fluorescence;DCCS;2,5-Pyrrolidinedione, 1-[[[7-(diethylaMino)-2-oxo-2H-1-benzopyran-3-yl]carbonyl]oxy]-;7-(N,N-diethylamino)coumarin-3-carboxylic acid succinimidyl ester | | CAS: | 139346-57-9 | | MF: | C18H18N2O6 | | MW: | 358.35 | | EINECS: | | | Product Categories: | Coumarines | | Mol File: | 139346-57-9.mol |  |
| | 7-Diethylaminocoumarin-3-carboxylic acid, succinimidyl ester Chemical Properties |
| Boiling point | 559.3±60.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMF: soluble | | pka | 2.60 ± 0.20, most basic, temperature:
25 °C | | form | Solid | | color | Yellow solid;Bright yellow solid;Orange powder | | λmax | 442 nm (Buffer pH 9) | | BRN | 5359433 | | Major Application | Silica particles/beads | | Biological Applications | Detecting aminoacids, hydrogen peroxide, metal ions/smallmolecules; detecting/identifying uronium salts;identifying chromosome,genome; monitoringproteolysis;quantifying analytes;as a substrate formeasuring extracellular matrix metalloprotease (MMP-1)activity, proteases activity; measuring lysosomalmembrane potential in situ; colloidal diagnosticdevices; useful for synthesizing peptides | | InChI | InChI=1S/C18H18N2O6/c1-3-19(4-2)12-6-5-11-9-13(17(23)25-14(11)10-12)18(24)26-20-15(21)7-8-16(20)22/h5-6,9-10H,3-4,7-8H2,1-2H3 | | InChIKey | NUNPVRICKDZFLK-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(N(CC)CC)=CC=C2C=C1C(ON1C(=O)CCC1=O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10-21 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 7-Diethylaminocoumarin-3-carboxylic acid, succinimidyl ester Usage And Synthesis |
| Uses | Derivatives of 7-aminocoumarins are the most extensively utilized labeling reagents for preparing brightly blue fluorescent conjugates of proteins and nucleic acid. The flourescent-labelling better matches the excitation-wavelength of standard blue lasers | | Uses | 7-(Diethylamino)coumarin-3-carboxylic acid N-succinimidyl ester is an amine reactive fluorescent probe. |
| | 7-Diethylaminocoumarin-3-carboxylic acid, succinimidyl ester Preparation Products And Raw materials |
|