| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(Dimethylamino)cinnamic acid Basic information |
| | 4-(Dimethylamino)cinnamic acid Chemical Properties |
| Melting point | 227-228 °C (dec.)(lit.) | | Boiling point | 326.97°C (rough estimate) | | density | 1.1258 (rough estimate) | | refractive index | 1.5220 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Crystalline Powder | | pka | -95.54±0.10(Predicted) | | color | Yellow to beige | | BRN | 1368533 | | Major Application | peptide synthesis | | InChI | 1S/C11H13NO2/c1-12(2)10-6-3-9(4-7-10)5-8-11(13)14/h3-8H,1-2H3,(H,13,14)/b8-5+ | | InChIKey | CQNPVMCASGWEHM-VMPITWQZSA-N | | SMILES | CN(C)c1ccc(\C=C\C(O)=O)cc1 | | CAS DataBase Reference | 1552-96-1(CAS DataBase Reference) | | NIST Chemistry Reference | 3-(p-(Dimethylamino)phenyl)acrylic acid(1552-96-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | T | | HS Code | 29224985 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Dimethylamino)cinnamic acid Usage And Synthesis |
| Chemical Properties | Yellow to beige crystalline powder | | Uses | peptide synthesis | | Purification Methods | Recrystallise the acid from EtOH. The methyl ester has m 134-135o (from Me2CO), and the ethyl ester has m 77-78o (from aqueous EtOH). [Shoppee J Chem Soc 982 1938, Galat J Am Chem Soc 68 376 1946, Beilstein 14 H 522, 14 II 318, 14 III 1306, 14 IV 1716.] |
| | 4-(Dimethylamino)cinnamic acid Preparation Products And Raw materials |
|