| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
SF7-am 95% (HPLC) manufacturers
|
| | SF7-am 95% (HPLC) Basic information |
| Product Name: | SF7-am 95% (HPLC) | | Synonyms: | SF7-AM;N-[2-[(Acetyloxy)methoxy]-2-oxoethyl]-N-[(3',6'-diazido-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl)carbonyl]glycine (acetyloxy)methyl ester;acetyloxymethyl 2-[[2-(acetyloxymethoxy)-2-oxoethyl]-(3',6'-diazido-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]acetate;SF7-AM;Bis(acetoxymethyl) 2,2'-((3',6'-diazido-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-5-carbonyl)azanediyl)diacetate;SF7-am 95% (HPLC) | | CAS: | 1416872-50-8 | | MF: | C31H23N7O12 | | MW: | 685.56 | | EINECS: | | | Product Categories: | | | Mol File: | 1416872-50-8.mol |  |
| | SF7-am 95% (HPLC) Chemical Properties |
| Melting point | 160-165°C | | storage temp. | -20°C | | solubility | DMF: 10 mg/ml; DMF:PBS (pH 7.2) (1:1): 0.5 mg/ml; DMSO: 5 mg/ml | | form | A crystalline solid | | color | White to light brown | | InChIKey | KVUJKFQKNGAJST-UHFFFAOYSA-N | | SMILES | CC(OCOC(CN(CC(OCOC(C)=O)=O)C(C1=CC=C(C(OC23C4=C(C=C(N=[N+]=[N-])C=C4)OC5C2C=CC(N=[N+]=[N-])=C5)=O)C3=C1)=O)=O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | SF7-am 95% (HPLC) Usage And Synthesis |
| Description | SF7-AM is a hydrogen sulphide (H2S) fluorescent probe for imaging H2O2-dependent H2S production. | | Uses | Sulfidefluor 7 AM is a fluorescent probe that is used for imaging H2O2-dependent H2S production. | | storage | Store at -20°C | | Excitation / Emission Maximum | 495 nm/520 nm |
| | SF7-am 95% (HPLC) Preparation Products And Raw materials |
|