| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
2-bromo-5-(tert-butyl)-1,3-dimethylbenzene manufacturers
|
| | 2-bromo-5-(tert-butyl)-1,3-dimethylbenzene Basic information |
| Product Name: | 2-bromo-5-(tert-butyl)-1,3-dimethylbenzene | | Synonyms: | 2-bromo-5-(tert-butyl)-1,3-dimethylbenzene;Benzene, 2-bromo-5-(1,1-dimethylethyl)-1,3-dimethyl-;2-Bromo-1,3-dimethyl-5-(2-methyl-2-propanyl)benzene;4-tert-butyl-2,6-dimethylbromobenzene;4-tert-butly-2,6-dimethylbromobenzene;2-Bromo-5-tert-butyl-1,3-dimethylbenzen;2-Bromo-5-tert-butyl-1,3-xylene | | CAS: | 5345-05-1 | | MF: | C12H17Br | | MW: | 241.17 | | EINECS: | | | Product Categories: | | | Mol File: | 5345-05-1.mol |  |
| | 2-bromo-5-(tert-butyl)-1,3-dimethylbenzene Chemical Properties |
| Melting point | 50 °C | | Boiling point | 129-133 °C(Press: 11-12 Torr) | | density | 1.177±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C12H17Br/c1-8-6-10(12(3,4)5)7-9(2)11(8)13/h6-7H,1-5H3 | | InChIKey | HAIGIJCTBFVMEP-UHFFFAOYSA-N | | SMILES | C1(C)=CC(C(C)(C)C)=CC(C)=C1Br |
| | 2-bromo-5-(tert-butyl)-1,3-dimethylbenzene Usage And Synthesis |
| | 2-bromo-5-(tert-butyl)-1,3-dimethylbenzene Preparation Products And Raw materials |
|