Posaconazole Impurity 17 manufacturers
|
| | Posaconazole Impurity 17 Basic information |
| Product Name: | Posaconazole Impurity 17 | | Synonyms: | (3S,5S,2R,3S)-posaconazole;Posacozole Impurity 17;Posaconazole Diastereoisomer - (R,R,S,R);Posaconazole Impurity(R,R,S,R);D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(2,4-difluorophenyl)-4-[[4-[4-[4-[1-[(1S,2R)-1-ethyl-2-hydroxypropyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-;4-(4-(4-(4-(((3R,5R)-5-((1H-1,2,4-triazol-1-yl)methyl)-5-(2,4-difluorophenyl)tetrahydrofuran-3-yl)me;Posaconazole Impurity 21(D-cis:2R,3S);Posaconazole Impurity 17(R,R,R,S) | | CAS: | 171228-51-6 | | MF: | C37H42F2N8O4 | | MW: | 700.79 | | EINECS: | | | Product Categories: | | | Mol File: | 171228-51-6.mol |  |
| | Posaconazole Impurity 17 Chemical Properties |
| Boiling point | 850.7±75.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | pka | 14.72±0.20(Predicted) | | InChIKey | RAGOYPUPXAKGKH-YUVGKPJTNA-N | | SMILES | C(N1N=CN=C1)[C@@]1(C2C=CC(F)=CC=2F)OC[C@@H](COC2C=CC(N3CCN(C4C=CC(N5C=NN([C@@H](CC)[C@H](O)C)C5=O)=CC=4)CC3)=CC=2)C1 |&1:6,17,36,39,r| |
| | Posaconazole Impurity 17 Usage And Synthesis |
| | Posaconazole Impurity 17 Preparation Products And Raw materials |
|