| Company Name: |
Hangzhou Huarong Pharm Co., Ltd. |
| Tel: |
571-86758373 +8613588754946 |
| Email: |
sales@huarongpharm.com |
| Products Intro: |
Product Name:4-(4-(4-(4-(((3R,5S)-5-((1H-1,2,4-triazol-1-yl)methyl)-5-(2,4-difluoro phenyl)tetrahydrofuran-3-yl)methoxy)phenyl)piperazin-1-yl)phenyl)-1-((2R,3R)-2-hydroxypentan-3-yl)-1H-1,2,4-triazol-5(4H)-one
CAS:1229428-89-0
Purity:0.99 Package:10MG,50MG,100MG,1G
|
|
|
|
|
|
| | Posaconazole iMpurity Basic information |
| Product Name: | Posaconazole iMpurity | | Synonyms: | Posaconazole Diastereoisomer 10;Posaconazole Diastereoisomer 14;Posaconazole IMP;Posaconazole Impurity S;2,6-Difluoro Posaconazole;ent-Posaconazole;(3R,5S,2R,3R)-posaconazole;4-(4-(4-(4-(((3R,5S)-5-((1H-1,2,4-triazol-1-yl)methyl) | | CAS: | 1229428-89-0 | | MF: | C37H42F2N8O4 | | MW: | 700.79 | | EINECS: | | | Product Categories: | | | Mol File: | 1229428-89-0.mol |  |
| | Posaconazole iMpurity Chemical Properties |
| Boiling point | 850.7±75.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | pka | 14.72±0.20(Predicted) | | InChIKey | RAGOYPUPXAKGKH-KVGKLONDNA-N | | SMILES | C(N1N=CN=C1)[C@]1(C2C=CC(F)=CC=2F)OC[C@@H](COC2C=CC(N3CCN(C4C=CC(N5C=NN([C@H](CC)[C@H](O)C)C5=O)=CC=4)CC3)=CC=2)C1 |&1:6,17,36,39,r| |
| | Posaconazole iMpurity Usage And Synthesis |
| Uses | ent-Posaconazole is an enantiomer of Posaconazole (P689600), which is an orally active triazole antifungal. |
| | Posaconazole iMpurity Preparation Products And Raw materials |
|