- Trimethylquinone
-
- $150.00 / 1kg
-
2025-05-23
- CAS:935-92-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 500kg
- TRIMETHYLQUINONE
-
- $11.00 / 1KG
-
2019-07-06
- CAS: 935-92-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000KG
|
| | TRIMETHYLQUINONE Basic information |
| Product Name: | TRIMETHYLQUINONE | | Synonyms: | 2,5-Cyclohexadiene-1,4-dione,2,3,5-triMethyl-;2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;TRIMETHYLQUINONE;2,3,5-Trimethyl-1,4-benzoquinone;2,3,5-trimethyl-2,5-cyclohexadien-1,4-dione;2,3,5-Trimethyl-2,5-cyclohexadiene-1,4-dione;2,3,5-Trimethylbenzoquinone;2,3,5-trimethyl-p-benzoquinon | | CAS: | 935-92-2 | | MF: | C9H10O2 | | MW: | 150.17 | | EINECS: | 213-309-2 | | Product Categories: | | | Mol File: | 935-92-2.mol |  |
| | TRIMETHYLQUINONE Chemical Properties |
| Melting point | 36 °C | | Boiling point | 211.72°C (rough estimate) | | density | 0.9820 (rough estimate) | | refractive index | 1.5470 (estimate) | | storage temp. | 2-8°C | | solubility | soluble in Acetone | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C9H10O2/c1-5-4-8(10)6(2)7(3)9(5)11/h4H,1-3H3 | | InChIKey | QIXDHVDGPXBRRD-UHFFFAOYSA-N | | SMILES | C1(=O)C=C(C)C(=O)C(C)=C1C | | CAS DataBase Reference | 935-92-2 | | EPA Substance Registry System | 2,5-Cyclohexadiene-1,4-dione, 2,3,5-trimethyl- (935-92-2) |
| TSCA | TSCA listed | | HS Code | 2914.69.9000 |
| | TRIMETHYLQUINONE Usage And Synthesis |
| Chemical Properties | Yellow crystal | | Uses | Through a catalytic redox chain ring opening Trimethylquinone can be used to Synthesize Quinone-Containing Carboxylic Acids | | Purification Methods | Distil the quinone in a vacuum or sublime it in vacuo before use. [Smith et al. J Am Chem Soc 60 318 1939, Beilstein 7 H 161, 7 III 3407, 7 IV 2098.] |
| | TRIMETHYLQUINONE Preparation Products And Raw materials |
|