| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
- Loxiglumide
-
- $127.00
-
2026-07-27
- CAS:107097-80-3
- Purity: 99.81%
- Supply Ability: 10g
|
| | LOXIGLUMIDE Basic information |
| Product Name: | LOXIGLUMIDE | | Synonyms: | 4-[(3,4-dichlorobenzoyl)amino]-5-[3-methoxypropyl(pentyl)amino]-5-oxopentanoic acid;4-[(3,4-dichlorophenyl)carbonylamino]-5-[3-methoxypropyl(pentyl)amino]-5-oxo-pentanoic acid;5-[amyl(3-methoxypropyl)amino]-4-[(3,4-dichlorobenzoyl)amino]-5-keto-valeric acid;LoxigluMide (CR1505);LOXIGLUMIDE;CS-162;Loxiglumide, >98%;(+-)-4-((3,4-dichlorobenzoyl)amino)-5-((3-methoxypropyl)pentylamino)-5-oxope | | CAS: | 107097-80-3 | | MF: | C21H30Cl2N2O5 | | MW: | 461.38 | | EINECS: | | | Product Categories: | Inhibitors | | Mol File: | 107097-80-3.mol |  |
| | LOXIGLUMIDE Chemical Properties |
| Melting point | 113-115℃ | | Boiling point | 632.2±55.0 °C(Predicted) | | density | 1.233±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ≥5mg/mL | | pka | pKa ~5(at 25℃) | | form | powder | | color | white to beige | | InChI | 1S/C21H30Cl2N2O5/c1-3-4-5-11-25(12-6-13-30-2)21(29)18(9-10-19(26)27)24-20(28)15-7-8-16(22)17(23)14-15/h7-8,14,18H,3-6,9-13H2,1-2H3,(H,24,28)(H,26,27) | | InChIKey | QNQZBKQEIFTHFZ-UHFFFAOYSA-N | | SMILES | CCCCCN(CCCOC)C(=O)C(CCC(O)=O)NC(=O)c1ccc(Cl)c(Cl)c1 | | CAS DataBase Reference | 107097-80-3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | LOXIGLUMIDE Usage And Synthesis |
| Uses | Loxiglumide is a CCK1 antagonist. Suppresses CCK-induced proliferation of acinar cells. Inhibits pancreatic secretion of digestive enzymes. Active in vivo. | | Definition | ChEBI: Loxiglumide is an organic molecular entity. | | Biochem/physiol Actions | Loxiglumide is a small-molecule antagonist of the cholecystokinin receptor CCKA. Loxiglumide inhibits pancreatic secretion of digestive enzymes, and also blocks CCK-induced gastric secretions and emptying. | | Safety Profile | A poison by
intravenous. Moderately toxic by ingestion,
intraperitoneal, and subcutaneous routes.
When heated to decomposition it emits
toxic vapors of NOx and Cl-. | | storage | Store at -20°C |
| | LOXIGLUMIDE Preparation Products And Raw materials |
|