| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
H-Ala-4m-betana HCl manufacturers
- H-ALA-4M-BETANA HCL
-
- $1.00
-
2024-07-25
- CAS:3438-14-0
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | H-Ala-4m-betana HCl Basic information |
| | H-Ala-4m-betana HCl Chemical Properties |
| storage temp. | −20°C | | solubility | water: 50 mg/mL, clear, colorless | | form | powder | | Water Solubility | water: 50mg/mL, clear, colorless | | InChI | 1S/C14H16N2O2.ClH/c1-9(15)14(17)16-11-7-10-5-3-4-6-12(10)13(8-11)18-2;/h3-9H,15H2,1-2H3,(H,16,17);1H/t9-;/m0./s1 | | InChIKey | ZEKFPQBOUDNNNH-FVGYRXGTSA-N | | SMILES | Cl.COc1cc(NC(=O)[C@H](C)N)cc2ccccc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | H-Ala-4m-betana HCl Usage And Synthesis |
| | H-Ala-4m-betana HCl Preparation Products And Raw materials |
|