| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (S)-2-Amino-5-(1,3-dioxolan-2-yl)-pentanoic acid Basic information |
| Product Name: | (S)-2-Amino-5-(1,3-dioxolan-2-yl)-pentanoic acid | | Synonyms: | L-Allysine ethylene acetal;L-Allysinethylenacetal;L-Allysine ethylene acetal >=98% (TLC);1,3-Dioxolane-2-pentanoic acid, α-amino-, (αS)-;(S)-2-AMINO-5-(1,3-DIOXOLAN-2-YL)-PENTANOIC ACID USP/EP/BP;L-Allysine ethylene acetal;(αS)-α-Amino-1,3-dioxolane-2-pentanoic acid;(S)-2-Amino-5-(1,3-dioxolan-2-yl)-pentanoic acid | | CAS: | 215054-80-1 | | MF: | C8H15NO4 | | MW: | 189.21 | | EINECS: | | | Product Categories: | | | Mol File: | 215054-80-1.mol |  |
| | (S)-2-Amino-5-(1,3-dioxolan-2-yl)-pentanoic acid Chemical Properties |
| Melting point | >200 °C (decomp) | | Boiling point | 338.7±27.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | pka | 2.53±0.24(Predicted) | | form | solid | | color | White | | Optical Rotation | [α]/D +4.0±0.3°, c = 1 in H2O | | Major Application | peptide synthesis | | InChI | 1S/C8H15NO4/c9-6(8(10)11)2-1-3-7-12-4-5-13-7/h6-7H,1-5,9H2,(H,10,11)/t6-/m0/s1 | | InChIKey | RQULWPSGQYZREI-LURJTMIESA-N | | SMILES | N[C@@H](CCCC1OCCO1)C(O)=O |
| WGK Germany | 1 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | (S)-2-Amino-5-(1,3-dioxolan-2-yl)-pentanoic acid Usage And Synthesis |
| Uses | peptide synthesis | | Definition | ChEBI: L-Allysine Ethylene Acetal is a L-alpha-amino acid. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | (S)-2-Amino-5-(1,3-dioxolan-2-yl)-pentanoic acid Preparation Products And Raw materials |
|