|
|
| | 1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil Basic information |
| Product Name: | 1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil | | Synonyms: | 2’-fluoro-5-ethyl-1-beta-d-arabinofuranosyluracil;1,3-Dimethyl-4-Amino-5-Formamide-Uracil FAU;1-(2'-Deoxy-2'-fluoro-b-D-arabinofuranosyl)uracil;1-[(2R,3S,4R,5R)-3-Fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione;2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-2-fluoro-β-D-arabinofuranosyl)-;2'-Fluoro-arabinofuranosyl-2'-deoxy-uridine;2'-Deoxy-2'-fluoro-beta-D-arabinouridine;2,4(1H,3H)-PyriMidinedione, 1-(2-deoxy-2-fluoro-b-D-arabinofuranosyl)- | | CAS: | 69123-94-0 | | MF: | C9H11FN2O5 | | MW: | 246.19 | | EINECS: | | | Product Categories: | Nucleosides-2'-FANA Nucleosides | | Mol File: | 69123-94-0.mol |  |
| | 1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil Chemical Properties |
| Melting point | 162 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) | | density | 1.63±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol: Soluble | | pka | 9.39±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1/C9H11FN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6+,7-,8-/s3 | | InChIKey | UIYWFOZZIZEEKJ-QOUWCGOQNA-N | | SMILES | [C@@H]1([C@@H](F)[C@H](O)[C@@H](CO)O1)N1C=CC(=O)NC1=O |&1:0,1,3,5,r| | | CAS DataBase Reference | 69123-94-0 |
| | 1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil Usage And Synthesis |
| Chemical Properties | Colourless solid | | Uses | 1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil is a purine nucleoside analogue. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. | | References | [1] Robak T, Robak P. Purine nucleoside analogs in the treatment of rarer chronic lymphoid leukemias. Curr Pharm Des. 2012;18(23):3373-88. DOI:10.2174/138161212801227005
[2] KYOICHI A. WATANABE. Nucleosides. 110. Synthesis and antiherpes virus activity of some 2’-fluoro-2’-deoxyarabinofuranosylpyrimidine nucleosides[J]. Journal of Medicinal Chemistry, 1979, 22 1: 21-24. DOI: 10.1021/jm00187a005 |
| | 1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)uracil Preparation Products And Raw materials |
|