| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:Dansyl-D-Ala-Gly-4-nitro-Phe-Gly-OH CAS:83960-27-4 Remarks:332P460
|
|
| | N-DANSYL-D-ALA-GLY-4-NITRO-PHE-GLY Basic information |
| | N-DANSYL-D-ALA-GLY-4-NITRO-PHE-GLY Chemical Properties |
| storage temp. | −20°C | | solubility | methanol: 50mg | | form | powder | | Sequence | {Dansyl}-{d-Ala}-Gly-{Phe(pNO2)}-Gly | | InChIKey | MIHGGGACSSHXPY-UHFFFAOYSA-N | | SMILES | CC(NS(=O)(=O)c1cccc2c(cccc12)N(C)C)C(=O)NCC(=O)NC(Cc3ccc(cc3)N(=O)=O)C(=O)NCC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-DANSYL-D-ALA-GLY-4-NITRO-PHE-GLY Usage And Synthesis |
| Uses | Dansyl-D-Ala-Gly-Phe(pNO2)-Gly is a synthetic peptide substrate. As a substrate of NEP, Dansyl-D-Ala-Gly-Phe(pNO2)-Gly can be specifically recognized and cleaved by the enzyme, thereby releasing the fluorophore dansyl, which can be quantitatively detected. Therefore, it is often used to determine the activity of NEP[1]. | | References | [1] Niikura T, et al. A humanin derivative reduces amyloid beta accumulation and ameliorates memory deficit in triple transgenic mice[J]. PloS one, 2011, 6(1): e16259. DOI:10.1371/journal.pone.0016259 |
| | N-DANSYL-D-ALA-GLY-4-NITRO-PHE-GLY Preparation Products And Raw materials |
|