| Company Name: |
Chemsoon Co., Ltd Gold |
| Tel: |
021-51987688-803 18916626396 |
| Email: |
info@chemsoon.com |
| Company Name: |
yimo organism Gold |
| Tel: |
15915870272; 15915870272 |
| Email: |
yimo_bio@163.com |
|
| | MIL-101(Cr) Basic information |
| Product Name: | MIL-101(Cr) | | Synonyms: | MIL-101(CR);Diaquatris[μ-[1,4-benzenedicarboxylato(2-)-κO1:κO'1]]fluoro-μ3-oxotriChromium hydrate(1:x);Metal Organic Frameworks (MOFs) MIL-101(Cr);XFF37;tris(chromium(3+)) | | CAS: | 869288-09-5 | | MF: | C24H16Cr3FO16 | | MW: | 735.36 | | EINECS: | | | Product Categories: | | | Mol File: | 869288-09-5.mol |  |
| | MIL-101(Cr) Chemical Properties |
| density | 0.58 g/cm3 | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Light green to green Solid | | InChI | InChI=1S/3C8H6O4.3Cr.FH.3H2O.O/c3*9-7(10)5-1-2-6(4-3-5)8(11)12;;;;;;;;/h3*1-4H,(H,9,10)(H,11,12);;;;1H;3*1H2;/q;;;+3;2*+4;;;;;-2/p-9 | | InChIKey | QQOADXNDUNUNLG-UHFFFAOYSA-E | | SMILES | [F-][Cr+3]12O=C(C3C=CC(C(=O)[O-])=CC=3)[O-][Cr+3]3(O=C(C4C=CC(C(=O)[O-])=CC=4)[O-][Cr+3](O=C(C4C=CC(C(=O)[O-])=CC=4)[O-]1)(O)[O-2]23)O.O |
| | MIL-101(Cr) Usage And Synthesis |
| Uses | MIL-101(Cr) is used as gas storage materials and adsorption materials. |
| | MIL-101(Cr) Preparation Products And Raw materials |
|