| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- Nivalenol
-
- $1.00
-
2019-07-06
- CAS:23282-20-4
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 1000kg
|
| | NIVALENOL Basic information |
| Product Name: | NIVALENOL | | Synonyms: | 3ALPHA,4BETA,7ALPHA,15-TETRAHYDROXY-12,13-EPOXYTRICHOTHEC-9-EN-8-ONE;NIVALENOL;12,13-epoxy-3,4,7,15-tetrahydroxytrichothec-9-en-8-one;12,13-epoxy-3-alpha,4-beta,7-alpha,15-tetrahydroxy-trichothec-9-en-8-on;12,13-epoxy-3alpha,4beta,7alpha,15-tetrahydroxy-trichothec-9-en-8-on;3-alpha,4-beta,7-alpha,15-tetrahydroxyscirp-9-en-8-one;trichothec-9-en-8-one,12,13-epoxy-3,4,7,15-tetrahydroxy-,(3-alpha,4-beta,7-al;trichothec-9-en-8-one,12,13-epoxy-3,4,7,15-tetrahydroxy-,(3alpha,4beta,7alpha | | CAS: | 23282-20-4 | | MF: | C15H20O7 | | MW: | 312.32 | | EINECS: | 621-749-5 | | Product Categories: | mycotoxin;Biotoxins;CRM&Matrix RMBiotoxins;Food and Agriculture CRM;Mycotoxins;NeatApplication CRMs;Other | | Mol File: | 23282-20-4.mol |  |
| | NIVALENOL Chemical Properties |
| Melting point | 222-223℃ | | alpha | 24D +21.54° (c = 1.3 in ethanol) | | Boiling point | 372.24°C (rough estimate) | | density | 1.2307 (rough estimate) | | refractive index | 1.4790 (estimate) | | Fp | 2 °C | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMSO: 25 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml | | pka | 11.78±0.70(Predicted) | | form | Solid | | color | Crystals from MeOH | | Henry's Law Constant | 1.4×1010 mol/(m3Pa) at 25℃, HSDB (2015) | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChI | 1S/C15H20O7/c1-6-3-7-14(4-16,11(20)8(6)17)13(2)10(19)9(18)12(22-7)15(13)5-21-15/h3,7,9-12,16,18-20H,4-5H2,1-2H3/t7-,9-,10-,11-,12-,13-,14-,15+/m1/s1 | | InChIKey | UKOTXHQERFPCBU-XBXCNEFVSA-N | | SMILES | [H][C@]12O[C@]3([H])[C@H](O)[C@@H](O)[C@@](C)([C@]34CO4)[C@@]1(CO)[C@H](O)C(=O)C(C)=C2 | | LogP | -1.558 (est) |
| | NIVALENOL Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Nivalenol is a mycotoxin found in wheat and maize which is produced by different Fusarium species that inhibit eukaryotic biosynthesis of protein.Environmental contaminants; Food contaminants | | Safety Profile | Poison by intravenous,intraperitoneal, and subcutaneous routes. Mutation datareported. A skin irritant. When heated to decomposition itemits acrid smoke and irritating fumes. |
| | NIVALENOL Preparation Products And Raw materials |
|