|
|
| | ISOCAPRONITRILE Basic information |
| Product Name: | ISOCAPRONITRILE | | Synonyms: | isobutylacetonitrile;Isoamyl Cyanide
4-Methylvaleronitrile;Pentanenitrile,4-methyl-;Valeronitrile, 4-methyl-;Isohexanenitrile;4-METHYLVALERONITRILE;ISOAMYL CYANIDE;ISOCAPRONITRILE | | CAS: | 542-54-1 | | MF: | C6H11N | | MW: | 97.16 | | EINECS: | 208-817-6 | | Product Categories: | | | Mol File: | 542-54-1.mol |  |
| | ISOCAPRONITRILE Chemical Properties |
| Melting point | -51° | | Boiling point | 155 °C | | density | 0,8 g/cm3 | | refractive index | 1.4050-1.4070 | | Fp | 45°C | | Water Solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Almost colorless | | Merck | 14,5117 | | Dielectric constant | 15.7(20℃) | | InChI | InChI=1S/C6H11N/c1-6(2)4-3-5-7/h6H,3-4H2,1-2H3 | | InChIKey | DUJMVKJJUANUMQ-UHFFFAOYSA-N | | SMILES | C(#N)CCC(C)C | | CAS DataBase Reference | 542-54-1 | | EPA Substance Registry System | Pentanenitrile, 4-methyl- (542-54-1) |
| Risk Statements | 10-23/24/25 | | Safety Statements | 16-26-36/37/39 | | RIDADR | 1992 | | RTECS | YV8588000 | | TSCA | TSCA listed | | HS Code | 2926.90.5050 | | HazardClass | 3.2 | | PackingGroup | III |
| | ISOCAPRONITRILE Usage And Synthesis |
| | ISOCAPRONITRILE Preparation Products And Raw materials |
|