|
|
| | N,N'-Dimethyl-1,2-ethanediamine Basic information |
| Product Name: | N,N'-Dimethyl-1,2-ethanediamine | | Synonyms: | N,N'-DimethylethyleneDiamines;DMEDA;Symmetrical dimethylethylenediamine;N,N'-Dimethylethylenediamine, 85%, tech;N,N'-Dimethylethylenediaminetech.85%;DMEN;N,N'-Dimethylethylenediamine, Technical Grade;N,N'-Dimethylethylenediamine,97% | | CAS: | 110-70-3 | | MF: | C4H12N2 | | MW: | 88.15 | | EINECS: | 203-793-3 | | Product Categories: | Polyamines;Building Blocks;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks;Aliphatics;Amines;bc0001;john's | | Mol File: | 110-70-3.mol |  |
| | N,N'-Dimethyl-1,2-ethanediamine Chemical Properties |
| Melting point | 1.63°C (estimate) | | Boiling point | 119 °C(lit.) | | density | 0.819 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.431(lit.) | | Fp | 83 °F | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Miscible with chloroform and dichloromethane. | | form | Liquid | | pka | 10.54±0.10(Predicted) | | Specific Gravity | 0.828 | | color | Clear colorless to slightly yellow | | Sensitive | Air Sensitive | | BRN | 878142 | | InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N | | LogP | -0.620 | | CAS DataBase Reference | 110-70-3(CAS DataBase Reference) | | NIST Chemistry Reference | CH3NHCH2CH2NHCH3(110-70-3) | | EPA Substance Registry System | 1,2-Ethanediamine, N,N'-dimethyl- (110-70-3) |
| Hazard Codes | C | | Risk Statements | 10-34-20/21/22 | | Safety Statements | 26-36/37/39-45-16 | | RIDADR | UN 2734 8/PG 2 | | WGK Germany | 3 | | RTECS | KV4250000 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29212900 | | Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. |
| | N,N'-Dimethyl-1,2-ethanediamine Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | Has a DNA binding effect | | Uses | N,N'-Dimethylethylenediamine is used in DNA binding effect. It is used to enhance the adsorption of carbon dioxide. It acts as a ligand and form coordination complex such as dinitrato(N,N'-dimethyl-1,2-ethanediamine)copper(II) and dichloro(1,4-bis-(diphenyl phosphino)butane)-(1,2-ethylenediamine)ruthenium(II). |
| | N,N'-Dimethyl-1,2-ethanediamine Preparation Products And Raw materials |
|