- 4-Methyl-2-nitrobenzonitrile
-
- $100.00 / 1KG
-
2025-09-25
- CAS:26830-95-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 4-Methyl-2-nitrobenzonitrile
-
- $15.00 / 1KG
-
2021-08-12
- CAS:26830-95-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-Methyl-2-nitrobenzonitrile Basic information |
| Product Name: | 4-Methyl-2-nitrobenzonitrile | | Synonyms: | 2-NITRO-P-TOLUNITRILE;2-NITRO-P-TOLUONITRILE;4-METHYL-2-NITROBENZONITRILE;2-nitro-4-toluonitrile;4-Methyl-2-nitrobenzonitrile,99%;3-(4-chlorophenyl)-5-cyclohexyl-1,3,5-thiadiazinane-2-thione;2-Nitro-p-tolunitrile>Benzonitrile, 4-methyl-2-nitro- | | CAS: | 26830-95-5 | | MF: | C8H6N2O2 | | MW: | 162.15 | | EINECS: | 248-019-5 | | Product Categories: | Aromatics Compounds;Aromatics | | Mol File: | 26830-95-5.mol |  |
| | 4-Methyl-2-nitrobenzonitrile Chemical Properties |
| Melting point | 97-99 °C(lit.) | | Boiling point | 288.82°C (rough estimate) | | density | 1.3264 (rough estimate) | | refractive index | 1.5770 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | form | Solid | | color | White Crystalline | | InChI | 1S/C8H6N2O2/c1-6-2-3-7(5-9)8(4-6)10(11)12/h2-4H,1H3 | | InChIKey | QGBSLPHQCUIZKK-UHFFFAOYSA-N | | SMILES | Cc1ccc(C#N)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 26830-95-5(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36-26 | | RIDADR | 3439 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 4-Methyl-2-nitrobenzonitrile Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | 4-Methyl-2-nitrobenzonitrile is used in the preparation of 4-cyano-3-nitrobenzyl bromide. | | Uses | 4-Methyl-2-nitrobenzonitrile was used in the preparation of 4-cyano-3-nitrobenzyl bromide. |
| | 4-Methyl-2-nitrobenzonitrile Preparation Products And Raw materials |
|