- Thiamiprine
-
- $293.00
-
2026-04-20
- CAS:5581-52-2
- Purity:
- Supply Ability: 10g
- GUANERAN
-
- $1.00
-
2020-02-05
- CAS:5581-52-2
- Min. Order: 1KG
- Purity: 98%-99.9%HPLC
- Supply Ability: 100KG
|
| | Guaneran Basic information |
| | Guaneran Chemical Properties |
| Melting point | >200℃ (DEC.) | | Boiling point | 564.6±60.0 °C(Predicted) | | density | 2.05 | | refractive index | 1.7400 (estimate) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 6.66±0.20(Predicted) | | color | Yellow | | Stability: | Light Sensitive | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C9H8N8O2S/c1-16-3-13-6(17(18)19)8(16)20-7-4-5(12-2-11-4)14-9(10)15-7/h2-3H,1H3,(H3,10,11,12,14,15) | | InChIKey | YFTWHEBLORWGNI-UHFFFAOYSA-N | | SMILES | S(c3[n](cnc3[N+](=O)[O-])C)c1nc(nc2[nH]cnc21)N | | CAS DataBase Reference | 5581-52-2 |
| RTECS | UO7505000 | | HS Code | 2933997500 |
| | Guaneran Usage And Synthesis |
| Uses | An immunosuppressant. Antiarthritic. | | Definition | ChEBI: Tiamiprine is an aryl sulfide. | | Brand name | Tiamiprine is INN. |
| | Guaneran Preparation Products And Raw materials |
|