| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 4,5-Dichloroimidazole
-
- $6.68
-
2020-01-13
- CAS:15965-30-7
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 4,5-Dichloroimidazole Basic information |
| | 4,5-Dichloroimidazole Chemical Properties |
| Melting point | 183-185 °C (lit.) | | Boiling point | 334.1±22.0 °C(Predicted) | | density | 1.613±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | pka | 8.99±0.10(Predicted) | | color | White to Light yellow | | Water Solubility | Insoluble in water. | | BRN | 606155 | | InChI | InChI=1S/C3H2Cl2N2/c4-2-3(5)7-1-6-2/h1H,(H,6,7) | | InChIKey | QAJJXHRQPLATMK-UHFFFAOYSA-N | | SMILES | C1NC(Cl)=C(Cl)N=1 | | CAS DataBase Reference | 15965-30-7(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39-36/37/39-22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933299090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4,5-Dichloroimidazole Usage And Synthesis |
| Uses | 4,5-Dichloroimidazole has been used in the synthesis of:
- phosphinite complexes
- 1-hexyl-3-methyl-4,5-dichloroimidazolium iodide, precursor required for the preparation of silver-carbene complex-loaded into L-tyrosine polyphosphate nanoparticles
|
| | 4,5-Dichloroimidazole Preparation Products And Raw materials |
|