- GERANYL CHLORIDE
-
-
2026-07-21
- CAS:5389-87-7
- Min. Order: 100G
- Purity: 95%
- Supply Ability: 20TONS
- GERANYL CHLORIDE
-
-
2026-03-20
- CAS:5389-87-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
- Geranyl Chloride
-
- $10.00
-
2023-02-13
- CAS:5389-87-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50MT
|
| | GERANYL CHLORIDE Basic information |
| Product Name: | GERANYL CHLORIDE | | Synonyms: | (e)-1-chloro-3,7-dimethyl-2,6-octadiene;7-dimethyl-6-octadien(e)-1-chloro-3;alpha,omega-octadiene;GERANYL CHLORIDE;(E)-1-CHLORO-3,7-DIMETHYL-OCTA-2,6-DIENE;1-CHLORO-3,7-DIMETHYL-2,6-OCTADIENE;Geranyl chloride 95%;(E)-8-Chloro-2,6-dimethyl-2,6-octadiene | | CAS: | 5389-87-7 | | MF: | C10H17Cl | | MW: | 172.7 | | EINECS: | | | Product Categories: | | | Mol File: | 5389-87-7.mol |  |
| | GERANYL CHLORIDE Chemical Properties |
| Boiling point | 102-104 °C/12 mmHg (lit.) | | density | 0.931 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4808(lit.) | | Fp | 194 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C10H17Cl/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ | | InChIKey | WLAUCMCTKPXDIY-JXMROGBWSA-N | | SMILES | C(Cl)/C=C(\C)/CC/C=C(/C)\C | | CAS DataBase Reference | 5389-87-7 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | RTECS | RG5275000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | GERANYL CHLORIDE Usage And Synthesis |
| Uses | Geranyl chloride was used as starting reagent in the synthesis of:
- C25 compound moenocinol
- 2-methyl-6-geranylphenol
- manoalide and seco-manoalide analogs
| | General Description | Geranyl chloride undergoes palladium-catalyzed cross-coupling reaction with aryl and alkenylgold(I) phosphanes to afford the α-substitution product. |
| | GERANYL CHLORIDE Preparation Products And Raw materials |
|