|
|
| | 1-Chloro-3-methyl-2-butene Basic information |
| Product Name: | 1-Chloro-3-methyl-2-butene | | Synonyms: | 1-Chloro-3-methyl-2-butene,95%,stab.withpotassiumcarbonate;1-CHLORO-3-METHYL-2-BUTENE , STABILIZED WITH POTASSIUM CARBONATE;1-CHLORO-3-METHYL-2-BUTENE 96+%;1-Chloro-3-methyl-2-butene (stabilized with K2CO3);1-Chloro-3-methyl-2-;3,3-Dimethylallyl chloride, Prenyl chloride;1-Chloro-3-methyl-2-butene,95% (99% min. total isomers);3,3-Dimethylallyl chloride, Prenyl chloride, 3-Methylbut-2-en-1-yl chloride | | CAS: | 503-60-6 | | MF: | C5H9Cl | | MW: | 104.58 | | EINECS: | 207-972-7 | | Product Categories: | API Intermediate;Alkenyl;Halogenated Hydrocarbons;Organic Building Blocks | | Mol File: | 503-60-6.mol |  |
| | 1-Chloro-3-methyl-2-butene Chemical Properties |
| Boiling point | 58-59 °C/120 mmHg (lit.) | | density | 0.928 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4488(lit.) | | RTECS | EM4298500 | | Fp | 56 °F | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Ethyl Acetate | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | Miscible with chloroform, acetone, diethyl ether and alcohol. Immiscible with water. | | InChI | InChI=1S/C5H9Cl/c1-5(2)3-4-6/h3H,4H2,1-2H3 | | InChIKey | JKXQKGNGJVZKFA-UHFFFAOYSA-N | | SMILES | C(Cl)/C=C(/C)\C | | CAS DataBase Reference | 503-60-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Butene, 1-chloro-3-methyl-(503-60-6) | | EPA Substance Registry System | 2-Butene, 1-chloro-3-methyl- (503-60-6) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-27-36/37/39 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29032990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 | | Hazardous Substances Data | 503-60-6(Hazardous Substances Data) |
| | 1-Chloro-3-methyl-2-butene Usage And Synthesis |
| Chemical Properties | Colorless Liquid | | Uses | 1-Chloro-3-methyl-2-butene is used in the synthesis of geraniol. It is also used as an alkylating agent and as a reagent in hyperforin. Further, it is used as an antibiotic to inhibit growth of tumor cells. | | General Description | Kinetics of gas-phase reactions of ozone with 1-chloro-3-methyl-2-butene was studied. Reaction of 1-chloro-3-methyl-2-butene with potassium iodide in acetone and sodium ethoxide in ethanol was studied. |
| | 1-Chloro-3-methyl-2-butene Preparation Products And Raw materials |
| Raw materials | Isoprene-->3-Methyl-1-butene | | Preparation Products | 10-(2-Benzothiazolyl)-2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-1H,5H,11H-(1)benzopyropyrano(6,7-8-I,j)quinolizin-11-one-->methyl(±)cis,trans-2,2-dimethyl-3-(2-methyl-1-propenyl cyclopropane carboxylate)-->Coumarin 314T-->9-Formyl-8-hydroxy-1,1,7,7-tetramethyljulolidine-->2-METHYLOCTANE-->ETHYL GERANATE-->2,2-dimethylbut-3-enoic acid-->8,8-dimethyl-9,10-dihydropyrano[2,3-h]chromen-2-one-->3,6-Heptadien-2-ol, 2,5,5-trimethyl- |
|