|
|
| | TETRAKIS(DIMETHYLAMINO)ETHYLENE Basic information |
| | TETRAKIS(DIMETHYLAMINO)ETHYLENE Chemical Properties |
| Melting point | >200 °C (decomp) | | Boiling point | 98°C 25mm | | density | 0.861 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.48(lit.) | | Fp | 53°C | | storage temp. | 0-10°C | | pka | 6.47±0.70(Predicted) | | form | clear liquid | | color | Light yellow to Yellow to Orange | | BRN | 1705900 | | Stability: | Stable. Incompatible with acid chlorides, acids, strong oxidizing agents, acid anhydrides, carbon dioxide, oxygen, chlorinated solvents. Reacts with oxygen in air to give a greenish-yellow emission. Flammable. | | InChI | [1S/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3] || 1S/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3 | | InChIKey | [CBXRMKZFYQISIV-UHFFFAOYSA-N] || CBXRMKZFYQISIV-UHFFFAOYSA-N | | SMILES | [CN(C)\C(N(C)C)=C(\N(C)C)N(C)C] || CN(C)\C(N(C)C)=C(\N(C)C)N(C)C | | CAS DataBase Reference | 996-70-3 | | NIST Chemistry Reference | Tetrakis(dimethylamino)ethylene(996-70-3) | | EPA Substance Registry System | Ethenetetramine, octamethyl- (996-70-3) |
| Hazard Codes | C | | Risk Statements | 10-34 | | Safety Statements | 16-27-36/37/39-45-26 | | RIDADR | 3286 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2921.29.0055 | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| Provider | Language |
|
ALFA
| English |
| | TETRAKIS(DIMETHYLAMINO)ETHYLENE Usage And Synthesis |
| Chemical Properties | light yellow-green liquid with an unpleasant | | Uses | Involved in TDAE methodology for coupling and intramolecular Buchwald reactions
Acts as a reducing agent
Reactant involved in:
- Dioxygenation
- Insertion of aluminum anion into the C-N bond
- Chemiluminescent reactions with oxygen
| | reaction suitability | reaction type: C-C Bond Formation | | Purification Methods | Impurities include tetramethylurea, dimethylamine, tetramethylethanediamine and tetramethyloxamide. It is washed with water while being flushed with nitrogen to remove dimethylamine, dried over molecular sieves, then passed through a silica gel column (previously activated at 400o) under nitrogen. De-gas it in a vacuum line by distillation from a trap at 50o to one at -70o. Finally, it is stirred over sodium-potassium alloy for several days. [Holroyd et al. J Phys Chem 89 4244 1985, Wiberg Angew Chem Int Ed Engl 7 766 1968, Beilstein 4 IV 167.] |
| | TETRAKIS(DIMETHYLAMINO)ETHYLENE Preparation Products And Raw materials |
|