|
|
| | 6-Chloropurine riboside Basic information |
| Product Name: | 6-Chloropurine riboside | | Synonyms: | 2-(6-chloropurin-9-yl)-5-hydroxyMethyltetrahydrofuran-3,4-diol;6-CLPR;6-CHLORO-9-BETA-D-RIBOFURANOSYL-9H-PURINE;6-CHLORO-9-(BETA-D-RIBOFURANOSYL)PURINE;6-CHLOROPURINE NUCLEOSIDE;6-CHLOROPURINE-9-BETA-D-RIBOFURANOSIDE;6-CHLOROPURINE-9-RIBOSIDE;6-CHLOROINOSINE | | CAS: | 5399-87-1 | | MF: | C10H11ClN4O4 | | MW: | 286.67 | | EINECS: | 226-438-4 | | Product Categories: | Bases & Related Reagents;Nucleotides | | Mol File: | 5399-87-1.mol |  |
| | 6-Chloropurine riboside Chemical Properties |
| Melting point | 158-162 °C (dec.) (lit.) | | Boiling point | 614.8±65.0 °C(Predicted) | | density | 2.03±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO (Sparingly, Heated), Methanol (Slightly, Heated), Water (Slightly, Heated, | | pka | 13.06±0.70(Predicted) | | form | Powder | | color | White to slightly yellow | | Water Solubility | Soluble in water. (10.6 mg/mL) | | BRN | 40573 | | InChI | InChI=1/C10H11ClN4O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2/t4-,6-,7-,10-/s3 | | InChIKey | XHRJGHCQQPETRH-HMEJCUHCSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(Cl)=NC=N3)N=C2)[C@H](O)[C@@H]1O |&1:2,4,15,17,r| | | CAS DataBase Reference | 5399-87-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | UO7520800 | | F | 10-23 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 6-Chloropurine riboside Usage And Synthesis |
| Chemical Properties | Colourless Crystalline Powder | | Uses | 6-Chloropurine riboside is used to study the kinetics and substrate specificity of adenosine deaminase. 6-Chloropurine riboside is benzoylated to facilitate synthesis of nucleoside derivatives such as 9-(2,3-Di-deoxy-2-fluoro-β-D-threo-pentofuranosyl)adenine. 6-Chloropurine riboside, especially after phosphorylation to NMP, NDP or NTP, is used as a purine substrate analogue in studies with enzymes such as Inosine monophosphate dehydrogenase (IMPDH); bacteriophage T4 RNA-ligase (EC 6.5.1.3) and pancreatic fibonuclease A. | | Uses | A substrate for adenosine deaminase |
| | 6-Chloropurine riboside Preparation Products And Raw materials |
|