|
|
| | (S)-3-Isopropyl-2,5-piperazinedione Basic information |
| | (S)-3-Isopropyl-2,5-piperazinedione Chemical Properties |
| Melting point | 256-262 °C | | Boiling point | 445.7±38.0 °C(Predicted) | | density | 1.087±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 13.12±0.40(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +29±2°, c = 1% in H2O | | BRN | 82869 | | InChI | InChI=1S/C7H12N2O2/c1-4(2)6-7(11)8-3-5(10)9-6/h4,6H,3H2,1-2H3,(H,8,11)(H,9,10)/t6-/m0/s1 | | InChIKey | IULFBTHVPRNQCG-LURJTMIESA-N | | SMILES | N1CC(=O)N[C@@H](C(C)C)C1=O | | CAS DataBase Reference | 16944-60-8(CAS DataBase Reference) |
| | (S)-3-Isopropyl-2,5-piperazinedione Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | (S)-3-Isopropyl-2,5-piperazinedione Preparation Products And Raw materials |
|