Z-Phe-Phe-fluoromethylketone manufacturers
|
| | Z-Phe-Phe-fluoromethylketone Basic information |
| Product Name: | Z-Phe-Phe-fluoromethylketone | | Synonyms: | Z-PHE-PHE-FMK;Z-FF-FMK;Carbamic acid, [2-[[3-fluoro-2-oxo-1-(phenylmethyl)propyl]amino]-2-oxo-1-(phenylmethyl)ethyl]-, phenylmethyl ester (9CI);(Rac)-Z-Phe-Phe-FMK;Cathepsin L-IN-2;Z-Phe-Phe-fluoromethylketone | | CAS: | 108005-94-3 | | MF: | C27H27FN2O4 | | MW: | 462.51 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Z-Phe-Phe-fluoromethylketone Chemical Properties |
| Boiling point | 707.5±60.0 °C(Predicted) | | density | 1.214±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO: 20mM | | form | solid | | pka | 11.07±0.46(Predicted) | | color | White to off-white | | InChI | 1S/C27H27FN2O4/c28-18-25(31)23(16-20-10-4-1-5-11-20)29-26(32)24(17-21-12-6-2-7-13-21)30-27(33)34-19-22-14-8-3-9-15-22/h1-15,23-24H,16-19H2,(H,29,32)(H,30,33) | | InChIKey | CAILNONEKASNSH-UHFFFAOYSA-N | | SMILES | FCC(=O)C(NC(=O)C(NC(=O)OCc3ccccc3)Cc2ccccc2)Cc1ccccc1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Z-Phe-Phe-fluoromethylketone Usage And Synthesis |
| Uses | Cathepsin L-IN-2 ((Rac)-Z-Phe-Phe-FMK) is an isomer of the Cathepsin L/B inhibitor Z-Phe-Phe-FMK (HY-141867), with an IC50 of 15 μM for cathepsin L. Z-Phe-Phe-FMK irreversibly blocks the proteolytic function of cathepsins by covalently binding to the cysteine residues in the active center of the enzyme. Cathepsin L-IN-2 and Z-Phe-Phe-FMK can be used to study neurodegenerative diseases (such as GRN-related frontotemporal dementia) and cancer invasion and metastasis. | | Biological Activity | Cell permeable: yes', 'Primary Target
cathepsin L', 'Product does not compete with ATP.', 'Reversible: no | | IC 50 | Cathepsin B; cathepsin L | | References | [1] Jonathan Frew, et al. Premature termination codon readthrough upregulates progranulin expression and improves lysosomal function in preclinical models of GRN deficiency. Mol Neurodegener. 2020 Mar 16;15(1):21. DOI:10.1186/s13024-020-00369-5 |
| | Z-Phe-Phe-fluoromethylketone Preparation Products And Raw materials |
|