2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL manufacturers
|
| | 2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Basic information |
| Product Name: | 2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL | | Synonyms: | 4-HYDROXY-3-METHOXYPHENYLBORONIC ACID, PINACOL CYCLIC ESTER;4-HYDROXY-3-METHOXYPHENYLBORONIC ACID PINACOL ESTER;2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL;2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol,min.97%;2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL, MIN. 97%;4-Hydroxy-3-methoxyphenylboronic acid, pinacol cyclic ester, 2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol,97%;2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol4-Hydroxy-3-methoxyphenylboronic acid pinacol ester | | CAS: | 269410-22-2 | | MF: | C13H19BO4 | | MW: | 250.1 | | EINECS: | | | Product Categories: | organic or inorganic borate;Boronic acids | | Mol File: | 269410-22-2.mol |  |
| | 2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Chemical Properties |
| Melting point | 105-109 °C(lit.) | | Boiling point | 367.3±32.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | Crystalline Powder | | pka | 9.66±0.35(Predicted) | | color | White to cream | | InChI | 1S/C13H19BO4/c1-12(2)13(3,4)18-14(17-12)9-6-7-10(15)11(8-9)16-5/h6-8,15H,1-5H3 | | InChIKey | WFSJROCEOJANPD-UHFFFAOYSA-N | | SMILES | COc1cc(ccc1O)B2OC(C)(C)C(C)(C)O2 | | CAS DataBase Reference | 269410-22-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Usage And Synthesis |
| Chemical Properties | white to cream crystalline powder | | Uses | 4-Hydroxy-3-methoxyphenylboronic acid, pinacol ester | | Uses | 4-Hydroxy-3-methoxyphenylboronic acid pinacol ester can be used as a reactant:
- In the Suzuki-Miyaura cross-coupling reaction.
- To prepare ethylidenedihydroindolones as potential neoplastic agents.
- To synthesize 5,6-dihydropyrrolo[2,1-b]isoquinoline derivatives, which can be utilized as scaffolds to prepare lamellarin analogs via regioselective bromination and Suzuki cross-coupling reactions.
|
| | 2-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL Preparation Products And Raw materials |
|