| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Basic information |
| Product Name: | 2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | | Synonyms: | 4-ACETOXY-3-METHOXYPHENYLBORONIC ACID, PINACOL ESTER;Phenol, 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 1-acetate;2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | | CAS: | 811841-45-9 | | MF: | C15H21BO5 | | MW: | 292.14 | | EINECS: | | | Product Categories: | | | Mol File: | 811841-45-9.mol |  |
| | 2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Chemical Properties |
| Melting point | 132-136 °C(lit.) | | storage temp. | 2-8°C | | InChI | 1S/C15H21BO5/c1-10(17)19-12-8-7-11(9-13(12)18-6)16-20-14(2,3)15(4,5)21-16/h7-9H,1-6H3 | | InChIKey | SQWMSVLBTLTANH-UHFFFAOYSA-N | | SMILES | COc1cc(ccc1OC(C)=O)B2OC(C)(C)C(C)(C)O2 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Usage And Synthesis |
| | 2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Preparation Products And Raw materials |
|