| Company Name: |
AF Biochem Co., Ltd. Gold |
| Tel: |
+86-028-60911900 13540204019 |
| Email: |
sales@afbiochem.com |
|
| | 3-PIPERIDIN-4-YL-PROPIONIC ACID Basic information |
| Product Name: | 3-PIPERIDIN-4-YL-PROPIONIC ACID | | Synonyms: | RARECHEM AK PQ 0384;Zinc04204051;3-(4-piperidinyl)propanoic acid(SALTDATA: HCl);3-PIPERIDIN-4-YL-PROPIONIC ACID;3-PIPERIDINE-4-YL-PROPIONIC ACID;3-Piperidin-4-yl-propionic acid ethyl ester.HCl;3-(4-piperidinyl)propanoic acid;3-(4-piperidin-1-iumyl)propanoate | | CAS: | 1822-32-8 | | MF: | C8H15NO2 | | MW: | 157.21 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 1822-32-8.mol |  |
| | 3-PIPERIDIN-4-YL-PROPIONIC ACID Chemical Properties |
| Melting point | 275-277℃ | | Boiling point | 299℃ | | density | 1.039 | | Fp | 135℃ | | pka | 4.66±0.10(Predicted) | | form | solid | | color | Off-white | | InChI | InChI=1S/C8H15NO2/c10-8(11)2-1-7-3-5-9-6-4-7/h7,9H,1-6H2,(H,10,11) | | InChIKey | AUYQMCCWFNSFGV-UHFFFAOYSA-N | | SMILES | N1CCC(CCC(O)=O)CC1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | HazardClass | IRRITANT | | HS Code | 2921309990 |
| | 3-PIPERIDIN-4-YL-PROPIONIC ACID Usage And Synthesis |
| | 3-PIPERIDIN-4-YL-PROPIONIC ACID Preparation Products And Raw materials |
|