| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4-Acetyl-3-fluorophenylboronic acid manufacturers
|
| | 4-Acetyl-3-fluorophenylboronic acid Basic information |
| Product Name: | 4-Acetyl-3-fluorophenylboronic acid | | Synonyms: | 4-ACETYL-3-FLUOROBENZENEBORONIC ACID;Boronic acid, B-(4-acetyl-3-fluorophenyl)-;4'-Borono-2'-fluoroacetophenone;B-(4-acetyl-3-fluorophenyl)-;B-(4-ACETYL-3-FLUOROPHENYL)-;;Boronic acid, (4-acetyl-3-fluorophenyl)-;4-Acetyl-3-fluorophenylboronic acid (contains varying amounts of Anhydride);(4-Acetyl-3-fluorophenyl)boronic acid - [A89684] | | CAS: | 481725-35-3 | | MF: | C8H8BFO3 | | MW: | 181.96 | | EINECS: | | | Product Categories: | Boronic acid | | Mol File: | 481725-35-3.mol |  |
| | 4-Acetyl-3-fluorophenylboronic acid Chemical Properties |
| Boiling point | 354.5±52.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 6.50±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C8H8BFO3/c1-5(11)7-3-2-6(9(12)13)4-8(7)10/h2-4,12-13H,1H3 | | InChIKey | YHEPWJRNHLTYSL-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C(C)=O)C(F)=C1)(O)O |
| Hazard Codes | C | | HazardClass | IRRITANT, CORROSIVE | | HS Code | 29310095 |
| | 4-Acetyl-3-fluorophenylboronic acid Usage And Synthesis |
| | 4-Acetyl-3-fluorophenylboronic acid Preparation Products And Raw materials |
|