| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-Acetylphenylboronic acid, pinacol ester manufacturers
|
| | 3-Acetylphenylboronic acid, pinacol ester Basic information |
| Product Name: | 3-Acetylphenylboronic acid, pinacol ester | | Synonyms: | 1-[3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]ETHANONE;2-dioxaborolan-2-yl)phenyl]ethanone;1-[3-(tetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethan-1-one;1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone ,98%;2-(3-Acetylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;Ethanone, 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-;3-Acetylbenzeneboronic acid pinacol ester;1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-one | | CAS: | 214360-49-3 | | MF: | C14H19BO3 | | MW: | 246.11 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 214360-49-3.mol |  |
| | 3-Acetylphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 51-52°C | | Boiling point | 362.5±25.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C14H19BO3/c1-10(16)11-7-6-8-12(9-11)15-17-13(2,3)14(4,5)18-15/h6-9H,1-5H3 | | InChIKey | CMMASGVZWZQOEY-UHFFFAOYSA-N | | SMILES | B2(OC(C(O2)(C)C)(C)C)c1cc(ccc1)C(=O)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 3-Acetylphenylboronic acid, pinacol ester Usage And Synthesis |
| Chemical Properties | Off-white crystal |
| | 3-Acetylphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|