|
|
| | 5-(1,3-Oxazol-5-yl)-2-thiophenesulfonyl chloride Basic information |
| Product Name: | 5-(1,3-Oxazol-5-yl)-2-thiophenesulfonyl chloride | | Synonyms: | 5-(1,3-oxazol-5-yl)-2-thiophenesulphonyl chloride;5-(1,3-Oxazol-5-yl)thiophene-2-sulphonyl chloride;2-Thiophenesulfonylchloride,5-(5-oxazolyl)-(9CI);BUTTPARK 95\50-77;5-(1,3-Oxazol-5-yl)thiophene-2-sulfonyl chloride;2-Thiophenesulfonyl chloride, 5-(5-oxazolyl)-;5-(Oxazol-5-yl)thiophene-2-sulfonyl chloride;5-(1,3-Oxazol-5-yl)-2-thiophenesulfonyl chloride | | CAS: | 321309-40-4 | | MF: | C7H4ClNO3S2 | | MW: | 249.69 | | EINECS: | | | Product Categories: | SULFONYLHALIDE | | Mol File: | 321309-40-4.mol |  |
| | 5-(1,3-Oxazol-5-yl)-2-thiophenesulfonyl chloride Chemical Properties |
| Melting point | 79-80°C | | form | solid | | color | Orange | | InChI | 1S/C7H4ClNO3S2/c8-14(10,11)7-2-1-6(13-7)5-3-9-4-12-5/h1-4H | | InChIKey | MAGTZUMWQUDWAH-UHFFFAOYSA-N | | SMILES | ClS(=O)(=O)c1ccc(s1)-c2cnco2 | | CAS DataBase Reference | 321309-40-4 |
| Hazard Codes | C,Xi | | Risk Statements | 34-36 | | Safety Statements | 26-36/37/39 | | RIDADR | 3261 | | WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 5-(1,3-Oxazol-5-yl)-2-thiophenesulfonyl chloride Usage And Synthesis |
| | 5-(1,3-Oxazol-5-yl)-2-thiophenesulfonyl chloride Preparation Products And Raw materials |
|