|
|
| | Z-GLY-PRO-ARG-PNA Basic information |
| Product Name: | Z-GLY-PRO-ARG-PNA | | Synonyms: | Z-GLY-PRO-ARG-PNA;carbobenzoxyglycyl-prolyl-arginine-4-nitroanilide;Z-GPR-pNA;L-Argininamide, N-[(phenylmethoxy)carbonyl]glycyl-L-prolyl-N-(4-nitrophenyl)- (9CI);Cbz-Gly-Pro-Arg-pNA;Z-Gly-Pro-Arg-pNA acetate | | CAS: | 66648-35-9 | | MF: | C27H34N8O7 | | MW: | 582.61 | | EINECS: | | | Product Categories: | ADC Linker | | Mol File: | 66648-35-9.mol |  |
| | Z-GLY-PRO-ARG-PNA Chemical Properties |
| density | 1.439±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | methanol: 20mg/mL, clear, colorless to light yellow | | form | powder | | pka | 11.344±0.46(predicted) | | Sequence | {Z-Gly}-Pro-Arg-{pNA} | | InChIKey | FPMAXHHYPVIJMC-VROPFNGYSA-N | | SMILES | CC(O)=O.NC(=N)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OCc2ccccc2)C(=O)Nc3ccc(cc3)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Z-GLY-PRO-ARG-PNA Usage And Synthesis |
| Uses | Z-Gly-Pro-Arg p-nitroanilide acetate salt has been used as a substrate in prostate-specific antigen (PSA) activation protease assay for determining enterokinase-PSA-trypsin (EK-PSA-TRP) activity and to perform kinetic experiments. It has also been used as a substrate to measure the pancreatic trypsin activity chromogenically. |
| | Z-GLY-PRO-ARG-PNA Preparation Products And Raw materials |
|