Z-GLY-GLY-PHE-OH manufacturers
- Z-GLY-GLY-PHE-OH
-
-
2025-04-04
- CAS:13171-93-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | Z-GLY-GLY-PHE-OH Basic information |
| Product Name: | Z-GLY-GLY-PHE-OH | | Synonyms: | Z-GLYCYL-GLYCYL-L-PHENYLALANINE;Z-GLY-GLY-PHE-OH;N-cbz-gly-gly-phe;N-carbobenzyloxy-Gly-Gly-Phe;(S)-11-Benzyl-3,6,9-trioxo-1-phenyl-2-oxa-4,7,10-triazadodecan-12-oic acid;(2S)-2-[2-(2-{[(benzyloxy)carbonyl]amino}acetamido)acetamido]-3-phenylpropanoic acid;N-(Benzyloxycarbonyl)glycylglycyl-L-phenylalanine;L-Phenylalanine, N-[(phenylmethoxy)carbonyl]glycylglycyl- | | CAS: | 13171-93-2 | | MF: | C21H23N3O6 | | MW: | 413.42 | | EINECS: | | | Product Categories: | | | Mol File: | 13171-93-2.mol |  |
| | Z-GLY-GLY-PHE-OH Chemical Properties |
| Boiling point | 771.2±60.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | form | Solid | | pka | 3.50±0.10(Predicted) | | color | White to light yellow | | Optical Rotation | 5.467°(C=0.01g/ml DMF) | | InChIKey | PARPWSYTROKYNG-KRWDZBQOSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)NC(=O)CNC(=O)CNC(OCC1=CC=CC=C1)=O |
| | Z-GLY-GLY-PHE-OH Usage And Synthesis |
| Uses | Z-Gly-Gly-Phe-OH is an active compound. Z-Gly-Gly-Phe-OH can be used for the synthesis of enzymic peptide[1]. | | References | [1] Kitaguchi. Hiroshi, et al. Enzymic peptide synthesis via segment condensation in the presence of water mimics. Journal of the American Chemical Society (1989), 111(26), 9272-3. |
| | Z-GLY-GLY-PHE-OH Preparation Products And Raw materials |
|