|
|
| | 1,4-Diamino-2,3-dihydroanthraquinone Basic information |
| Product Name: | 1,4-Diamino-2,3-dihydroanthraquinone | | Synonyms: | 1,4-Diamino-2,3-dihy;2,3-Dihydro-1,4-diaMino
anthraquinone;1,4-diaMino-2,3-dihydroanthracene-9,10-dione;1,4-diamino-2,3-dihydro-10-anthracenedione;10-Anthracenedione,1,4-diamino-2,3-dihydro-9;2,3-dihydro-1,4-diamino-anthraquinon;Anthraquinone, 1,4-diamino-2,3-dihydro-;Anthraquinone, 2,3-dihydro-1,4-diamino- | | CAS: | 81-63-0 | | MF: | C14H12N2O2 | | MW: | 240.26 | | EINECS: | 201-367-1 | | Product Categories: | Intermediates of Dyes and Pigments;Amines;Aromatics | | Mol File: | 81-63-0.mol |  |
| | 1,4-Diamino-2,3-dihydroanthraquinone Chemical Properties |
| Melting point | >190°C (dec.) | | Boiling point | 382.97°C (rough estimate) | | density | 1.1613 (rough estimate) | | refractive index | 1.6180 (estimate) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 5.11±0.20(Predicted) | | form | Solid | | color | Very Dark Green to Very Dark Brown | | InChI | InChI=1S/C14H12N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-4H,5-6,15-16H2 | | InChIKey | SSGALQHXKMAJTL-UHFFFAOYSA-N | | SMILES | C1(N)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=C(N)CC1 | | CAS DataBase Reference | 81-63-0(CAS DataBase Reference) | | NIST Chemistry Reference | 9,10-Anthracenedione, 1,4-diamino-2,3-dihydro-(81-63-0) | | EPA Substance Registry System | 9,10-Anthracenedione, 1,4-diamino-2,3-dihydro- (81-63-0) |
| | 1,4-Diamino-2,3-dihydroanthraquinone Usage And Synthesis |
| Description | 1,4-Diamino-2,3-dihydroanthraquinone (DDA) is a dark purple needle crystal. It is insoluble in water, but soluble in benzene, pyridine, nitrobenzene, and aniline. Can be used to prepare purple smoke bombs. It is highly susceptible to oxidation to 1,4-diaminoanthraquinone (DAA) in the air or during smoke bomb burning. DDA is a weak mutagen in the Salmonella Reversin Assay, and a combustion or oxidation product in the same test, and DAA is a strong mutagen. | | Chemical Properties | Dark Greenish Brown Solid | | Uses | Leuco-1,4-diaminoanthraquinone (leucamine) is an important precursor for 1,4-diaminoanthraquinone. | | Uses | An anthraquinone-derived dye. A product from the combustion of red and violet smoke mixtures. | | Properties and Applications | dark red light purple. |
| | 1,4-Diamino-2,3-dihydroanthraquinone Preparation Products And Raw materials |
|