|
|
| | N,N-Dimethylpiperidin-4-amine Basic information |
| | N,N-Dimethylpiperidin-4-amine Chemical Properties |
| Boiling point | 187°C | | density | 1.09g/ml | | Fp | 187°C | | refractive index | 1.4760 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.10±0.10(Predicted) | | form | liquid | | color | Clear, colourless | | BRN | 1190 | | InChI | InChI=1S/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 | | InChIKey | YFJAIURZMRJPDB-UHFFFAOYSA-N | | SMILES | N1CCC(N(C)C)CC1 | | CAS DataBase Reference | 50533-97-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 10-34-22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2734 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2933399990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | N,N-Dimethylpiperidin-4-amine Usage And Synthesis |
| Uses | 4-(Dimethylamino)piperidine is having molecular features associated with polyamine modulation of N-methyl-D-aspartate receptors. It is utilized as a mechanism for reducing the effects of alcohol dependence. | | Synthesis |  1-(tert-Butoxycarbonyl)-4-piperidone (998 mg, 4.75 mmol) in methanol (15 mL) was treated with dimethylamine hydrochloride (800 mg, 9.8 mmol) and sodium cyanoborohydride (270 mg, 4.3 mmol) at rt. After 4 days, concentrated HCl (10 mL) was added and the reaction was reduced in vacuo. The resulting residue was dissolved in H2O (30 mL) and treated with 2M NaOH solution to achieve a pH of 10. The aqueous solution was extracted with methylene chloride (3×20 mL) and the combined organics were dried over Na2SO4 and removed in vacuo. The resulting product is N,N-Dimethylpiperidin-4-amine (169 mg). | | storage | Incompatible with air, water, oxidizing agents and heat. |
| | N,N-Dimethylpiperidin-4-amine Preparation Products And Raw materials |
|